Products 799764-90-2
CAS 799764-90-2 is the registry number for 2-Benzyl 1-(tert-butyl) (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.
2-O-benzyl 1-O-tert-butyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate (CAS 799764-90-2) is a chemical compound with the molecular formula C18H23NO5 and a molecular weight of 333.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: SINJUUNBWYWVCW-JSGCOSHPSA-N.
| Molecular formula | C18H23NO5 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-methyl-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | SINJUUNBWYWVCW-JSGCOSHPSA-N |
| SMILES | C[C@H]1C[C@H](N(C1=O)C(=O)OC(C)(C)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)