Products 80020-16-2

CAS 80020-16-2 is the registry number for 4-Formyl-N,N-dipropylbenzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

4-formyl-N,N-dipropylbenzamide (CAS 80020-16-2) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 4-formyl-N,N-dipropylbenzamide. InChIKey: HYMRMNYAPYAECQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO2
Molecular weight233.31 g/mol
IUPAC name4-formyl-N,N-dipropylbenzamide
InChIKeyHYMRMNYAPYAECQ-UHFFFAOYSA-N
SMILESCCCN(CCC)C(=O)C1=CC=C(C=C1)C=O

Computed by PubChem (NCBI)