Products 80030-25-7
CAS 80030-25-7 is the registry number for 1,3:4,6-Di-O-benzylidene-D-threo-2,5-hexodiulose Hydrate. Offered by: TRC. Available pack sizes: 500mg, 50mg.
(1S,2S,7S,9S)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,7]tridecane-7,9-diol (CAS 80030-25-7) is a chemical compound with the molecular formula C20H20O7 and a molecular weight of 372.4 g/mol. IUPAC name: (1S,2S,7S,9S)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,7]tridecane-7,9-diol. InChIKey: WUBQHQQOSOSTHS-RWVLGTNRSA-N.
| Molecular formula | C20H20O7 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | (1S,2S,7S,9S)-4,12-diphenyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,7]tridecane-7,9-diol |
| InChIKey | WUBQHQQOSOSTHS-RWVLGTNRSA-N |
| SMILES | C1[C@]2([C@H]([C@H]3[C@@](O2)(COC(O3)C4=CC=CC=C4)O)OC(O1)C5=CC=CC=C5)O |
Computed by PubChem (NCBI)