CAS 33208-42-3 is the registry number for (2R,3R,4R,5R)-2-(Hydroxymethyl)-5-methoxytetrahydrofuran-3,4-diyl dibenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R,5R)-4-benzoyloxy-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] benzoate (CAS 33208-42-3) is a chemical compound with the molecular formula C20H20O7 and a molecular weight of 372.4 g/mol. IUPAC name: [(2R,3R,4R,5R)-4-benzoyloxy-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] benzoate. InChIKey: KYBHURZCCOIFKJ-WOCWXWTJSA-N.
| Molecular formula | C20H20O7 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-4-benzoyloxy-2-(hydroxymethyl)-5-methoxyoxolan-3-yl] benzoate |
| InChIKey | KYBHURZCCOIFKJ-WOCWXWTJSA-N |
| SMILES | CO[C@H]1[C@@H]([C@@H]([C@H](O1)CO)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)