CAS 53350-26-8 appears in our catalog under these names: 3',4',5',5,7-Pentamethoxyflavone, 95%, 3',4',5',5,7-Pentamethoxyflavone/ 98%, 3',4',5',5,7-Pentamethoxyflavone, 5,7-Dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one, 99.26% ,, 99.26% ,, 3',4',5',5,7-Pentamethoxyflavone, 99.45%. Offered by: Combi-blocks, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg.
5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (CAS 53350-26-8) is a chemical compound with the molecular formula C20H20O7 and a molecular weight of 372.4 g/mol. IUPAC name: 5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one. InChIKey: GIKVSFNAEBQLGB-UHFFFAOYSA-N.
| Molecular formula | C20H20O7 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| InChIKey | GIKVSFNAEBQLGB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C=C(O2)C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)