Products 101996-62-7

CAS 101996-62-7 is the registry number for Citric Acid 1,3-Dibenzylester. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-hydroxy-4-oxo-2-(2-oxo-2-phenylmethoxyethyl)-4-phenylmethoxybutanoic acid (CAS 101996-62-7) is a chemical compound with the molecular formula C20H20O7 and a molecular weight of 372.4 g/mol. IUPAC name: 2-hydroxy-4-oxo-2-(2-oxo-2-phenylmethoxyethyl)-4-phenylmethoxybutanoic acid. InChIKey: CNDXFEKBFFOHMG-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20O7
Molecular weight372.4 g/mol
IUPAC name2-hydroxy-4-oxo-2-(2-oxo-2-phenylmethoxyethyl)-4-phenylmethoxybutanoic acid
InChIKeyCNDXFEKBFFOHMG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)CC(CC(=O)OCC2=CC=CC=C2)(C(=O)O)O

Computed by PubChem (NCBI)