CAS 80074-34-6 is the registry number for Methyl 2-ethoxy-5-nitrobenzoate, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
Methyl 2-ethoxy-5-nitrobenzoate (CAS 80074-34-6) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: methyl 2-ethoxy-5-nitrobenzoate. InChIKey: ALHAOIFZKFHHAJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | methyl 2-ethoxy-5-nitrobenzoate |
| InChIKey | ALHAOIFZKFHHAJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)