CAS 80120-31-6 is the registry number for ethyl 2-(2,5-dimethylphenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Ethyl 2-(2,5-dimethylphenyl)-2-oxoacetate (CAS 80120-31-6) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: ethyl 2-(2,5-dimethylphenyl)-2-oxoacetate. InChIKey: SQJHKEYGAQOGPH-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | ethyl 2-(2,5-dimethylphenyl)-2-oxoacetate |
| InChIKey | SQJHKEYGAQOGPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=CC(=C1)C)C |
Computed by PubChem (NCBI)