CAS 80120-33-8 appears in our catalog under these names: Ethyl 2-(2,4-dimethylphenyl)-2-oxoacetate, 95%, 95%, Ethyl 2,4-dimethylbenzoylformate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 2-(2,4-dimethylphenyl)-2-oxoacetate (CAS 80120-33-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: ethyl 2-(2,4-dimethylphenyl)-2-oxoacetate. InChIKey: FMYSICOONSJFBX-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | ethyl 2-(2,4-dimethylphenyl)-2-oxoacetate |
| InChIKey | FMYSICOONSJFBX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=C(C=C1)C)C |
Computed by PubChem (NCBI)