CAS 80126-50-7 appears in our catalog under these names: H–D–Phe(2–Cl)–OH, 2-Chloro-D-phenylalanine, 98% , 2-Chloro-D-phenylalanine, 98%, 98%, H-D-Phe(2-Cl)-OH, 99.87%, 2-Chloro-D-phenylalanine, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 250mg, 25 g, 10 g.
(2R)-2-amino-3-(2-chlorophenyl)propanoic acid (CAS 80126-50-7) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (2R)-2-amino-3-(2-chlorophenyl)propanoic acid. InChIKey: CVZZNRXMDCOHBG-MRVPVSSYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-chlorophenyl)propanoic acid |
| InChIKey | CVZZNRXMDCOHBG-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)