CAS 80126-54-1 appears in our catalog under these names: (R)–2–Amino–3–(o–tolyl)propanoic acid, 2-Methyl-D-phenylalanine, 98%, 98%, (R)-2-Amino-3-(o-tolyl)propanoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 500mg, 2.5g, 10g, 25g.
(2R)-2-amino-3-(2-methylphenyl)propanoic acid (CAS 80126-54-1) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2R)-2-amino-3-(2-methylphenyl)propanoic acid. InChIKey: NHBKDLSKDKUGSB-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-methylphenyl)propanoic acid |
| InChIKey | NHBKDLSKDKUGSB-SECBINFHSA-N |
| SMILES | CC1=CC=CC=C1C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)