Products 80134-83-4
CAS 80134-83-4 appears in our catalog under these names: L–Leucine–1–13C,15N, L-Leucine-1-13C,15N, ≥98 atom% 13C,≥98 atom% 15N,≥98%, ≥98 atom% 13C,≥98 atom% 15N,≥98%, L-Leucine-1-13C,15N, 99.93%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 50mg, 5mg, 10 mg, 5 mg, 100 mg.
(2S)-2-(15N)azanyl-4-methyl(113C)pentanoic acid (CAS 80134-83-4) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 133.16 g/mol. IUPAC name: (2S)-2-(15N)azanyl-4-methyl(113C)pentanoic acid. InChIKey: ROHFNLRQFUQHCH-XAAHKOKXSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 133.16 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-4-methyl(113C)pentanoic acid |
| InChIKey | ROHFNLRQFUQHCH-XAAHKOKXSA-N |
| SMILES | CC(C)C[C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)