Products 80238-12-6
CAS 80238-12-6 appears in our catalog under these names: 2,6-Dimethylterephthalic acid, 96%, 2,6-Dimethylterephthalic acid 96%, 2，6-Dimethylterephthalic acid, 96%, 96%, 2,6-Dimethylterephthalic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
2,6-dimethylterephthalic acid (CAS 80238-12-6) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2,6-dimethylterephthalic acid. InChIKey: SIQYOFNSIZEILQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2,6-dimethylterephthalic acid |
| InChIKey | SIQYOFNSIZEILQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)C)C(=O)O |
Computed by PubChem (NCBI)