Products 80370-87-2
CAS 80370-87-2 is the registry number for 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)acetic Acid, 95%. Offered by: Chemat. Available pack sizes: 1g.
2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)acetic acid (CAS 80370-87-2) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)acetic acid. InChIKey: GUAFHEKEEYSSJU-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)acetic acid |
| InChIKey | GUAFHEKEEYSSJU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(CC2)CC(=O)O |
Computed by PubChem (NCBI)