CAS 80451-84-9 appears in our catalog under these names: 5-Ketomannose, 95%, 5-Ketomannose. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 50mg.
(2S,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexanal (CAS 80451-84-9) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: (2S,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexanal. InChIKey: ZAVYLQGLQYIKKF-UYFOZJQFSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | (2S,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexanal |
| InChIKey | ZAVYLQGLQYIKKF-UYFOZJQFSA-N |
| SMILES | C(C(=O)[C@H]([C@@H]([C@@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)