CAS 80591-17-9 is the registry number for 2-Chloro-6,7-dimethoxy-1,4-dihydroquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-6,7-dimethoxy-1,4-dihydroquinazoline (CAS 80591-17-9) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: 2-chloro-6,7-dimethoxy-1,4-dihydroquinazoline. InChIKey: JBRJEVUADFWVCK-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2 |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | 2-chloro-6,7-dimethoxy-1,4-dihydroquinazoline |
| InChIKey | JBRJEVUADFWVCK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CN=C(N2)Cl)OC |
Computed by PubChem (NCBI)