CAS 80635-91-2 is the registry number for 4–Methyl–2–(m–tolyl)pyridine. Offered by: GLPBio. Available pack sizes: 1g, 5g.
4-methyl-2-(3-methylphenyl)pyridine (CAS 80635-91-2) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 4-methyl-2-(3-methylphenyl)pyridine. InChIKey: YFOMNGOCTSDTAF-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 4-methyl-2-(3-methylphenyl)pyridine |
| InChIKey | YFOMNGOCTSDTAF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC=CC(=C2)C |
Computed by PubChem (NCBI)