Products 80789-75-9
CAS 80789-75-9 appears in our catalog under these names: 1-(P-Tolyl)-1-cyclopentanecarboxylic acid, 96%, 1-(4-Methylphenyl)cyclopentanecarboxylic acid, 98%, 1-(p-Tolyl)cyclopentanecarboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 25g, 10g, 100mg, 250mg.
1-(4-methylphenyl)cyclopentane-1-carboxylic acid (CAS 80789-75-9) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 1-(4-methylphenyl)cyclopentane-1-carboxylic acid. InChIKey: YKDWTRWSHHGVII-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 1-(4-methylphenyl)cyclopentane-1-carboxylic acid |
| InChIKey | YKDWTRWSHHGVII-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CCCC2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-(4-Methylphenyl)cyclopentanecarboxylic acid, 1-(p-Tolyl)cyclopentanecarboxylic acid, 1-(4-methylphenyl)cyclopentane-1-carboxylic acid, 1-(P-Tolyl)-1-Cyclopentanecarboxylic Acid, 1-(p-Tolyl)cyclopentane-1-carboxylic acid, Oprea1_524480, Oprea1_782755, Cyclopentanecarboxylic acid, 1-(4-methylphenyl)-, 1-p-Tolyl-cyclopentanecarboxylic acid, 1-(4-meth