Products 80877-15-2
CAS 80877-15-2 appears in our catalog under these names: Dl-3-cyanophenylalanine hydrochloride, 97%, Dl-3-cyanophenylalanine hydrochloride, 97%, 97%, 2-Amino-3-(3-cyanophenyl)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-amino-3-(3-cyanophenyl)propanoic acid;hydrochloride (CAS 80877-15-2) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: 2-amino-3-(3-cyanophenyl)propanoic acid;hydrochloride. InChIKey: BDRRPFSPUOEZJA-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2 |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | 2-amino-3-(3-cyanophenyl)propanoic acid;hydrochloride |
| InChIKey | BDRRPFSPUOEZJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)