Products 80882-42-4
CAS 80882-42-4 appears in our catalog under these names: 2-Chloro-4-(2-methyl-1,3-dioxolan-2-yl)pyridine, 95%, 2-Chloro-4-(2-methyl-1,3-dioxolan-2-yl)pyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-chloro-4-(2-methyl-1,3-dioxolan-2-yl)pyridine (CAS 80882-42-4) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2-chloro-4-(2-methyl-1,3-dioxolan-2-yl)pyridine. InChIKey: RGRVMRHXSHJQAX-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2-chloro-4-(2-methyl-1,3-dioxolan-2-yl)pyridine |
| InChIKey | RGRVMRHXSHJQAX-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)