Products 81018-31-7
CAS 81018-31-7 is the registry number for N-(5-Cyano-2-methylphenyl)acetamide, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
N-(5-cyano-2-methylphenyl)acetamide (CAS 81018-31-7) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: N-(5-cyano-2-methylphenyl)acetamide. InChIKey: TWARPZCNCWESBS-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | N-(5-cyano-2-methylphenyl)acetamide |
| InChIKey | TWARPZCNCWESBS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C#N)NC(=O)C |
Computed by PubChem (NCBI)