Products 81050-84-2
CAS 81050-84-2 is the registry number for AcrB-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-(2,4-dimethoxy-3,6-dimethylbenzoyl)oxy-2-hydroxy-3,6-dimethylbenzoate (CAS 81050-84-2) is a chemical compound with the molecular formula C21H24O7 and a molecular weight of 388.4 g/mol. IUPAC name: methyl 4-(2,4-dimethoxy-3,6-dimethylbenzoyl)oxy-2-hydroxy-3,6-dimethylbenzoate. InChIKey: WVDQDUDKODKATA-UHFFFAOYSA-N.
| Molecular formula | C21H24O7 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | methyl 4-(2,4-dimethoxy-3,6-dimethylbenzoyl)oxy-2-hydroxy-3,6-dimethylbenzoate |
| InChIKey | WVDQDUDKODKATA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OC)O)C)OC(=O)C2=C(C(=C(C=C2C)OC)C)OC |
Computed by PubChem (NCBI)