CAS 81067-38-1 appears in our catalog under these names: 1-Bromo-2,3,5-trichlorobenzene 96%, 1-Bromo-2,3,5-trichlorobenzene, 95%, 1-Bromo-2,3,5-trichlorobenzene, 96%, 96%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 50g, 250g.
1-bromo-2,3,5-trichlorobenzene (CAS 81067-38-1) is a chemical compound with the molecular formula C6H2BrCl3 and a molecular weight of 260.3 g/mol. IUPAC name: 1-bromo-2,3,5-trichlorobenzene. InChIKey: WOIGJFAVHOCDDW-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl3 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 1-bromo-2,3,5-trichlorobenzene |
| InChIKey | WOIGJFAVHOCDDW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Cl)Br)Cl |
Computed by PubChem (NCBI)