CAS 81172-89-6 appears in our catalog under these names: Terephthalaldehyde Mono(diethyl Acetal), Terephthalaldehyde mono(diethyl acetal), 97%, stab. , Terephthalaldehyde Mono(diethyl Acetal), >97.0%(GC), Terephthaldehyde monodiethylacetal, 97%, stabilized, 4-(Diethoxymethyl)benzaldehyde 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 100g, 25g, 5g, 25ml, 1g, 10g.
4-(diethoxymethyl)benzaldehyde (CAS 81172-89-6) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 4-(diethoxymethyl)benzaldehyde. InChIKey: HTMXMFARWHNJDW-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 4-(diethoxymethyl)benzaldehyde |
| InChIKey | HTMXMFARWHNJDW-UHFFFAOYSA-N |
| SMILES | CCOC(C1=CC=C(C=C1)C=O)OCC |
Computed by PubChem (NCBI)