CAS 811799-54-9 appears in our catalog under these names: tert-Butyl (4-acetyl-2-fluorophenyl)carbamate 97%, Boc 4-Acetyl-2-fluoroaniline, 85%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl N-(4-acetyl-2-fluorophenyl)carbamate (CAS 811799-54-9) is a chemical compound with the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. IUPAC name: tert-butyl N-(4-acetyl-2-fluorophenyl)carbamate. InChIKey: BZBOHIZOLKWWFS-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO3 |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | tert-butyl N-(4-acetyl-2-fluorophenyl)carbamate |
| InChIKey | BZBOHIZOLKWWFS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)NC(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)