CAS 81255-49-4 is the registry number for 4-Toluenesulfonyl-d7 Chloride. Offered by: TRC. Available pack sizes: 750mg.
2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzenesulfonyl chloride (CAS 81255-49-4) is a chemical compound with the molecular formula C7H7ClO2S and a molecular weight of 197.69 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzenesulfonyl chloride. InChIKey: YYROPELSRYBVMQ-AAYPNNLASA-N.
| Molecular formula | C7H7ClO2S |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzenesulfonyl chloride |
| InChIKey | YYROPELSRYBVMQ-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])S(=O)(=O)Cl)[2H] |
Computed by PubChem (NCBI)