CAS 812667-44-0 appears in our catalog under these names: 4-Bromo-2-methoxybenzamide, 98%, 4-Bromo-2-methoxybenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g.
4-bromo-2-methoxybenzamide (CAS 812667-44-0) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 4-bromo-2-methoxybenzamide. InChIKey: IVYKCTGCJDBWMQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 4-bromo-2-methoxybenzamide |
| InChIKey | IVYKCTGCJDBWMQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Br)C(=O)N |
Computed by PubChem (NCBI)