CAS 81322-67-0 appears in our catalog under these names: 3,5-Dimethyl-4-chloro-2-formylphenol, 95%, 3-Chloro-6-hydroxy-2,4-dimethylbenzaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
3-chloro-6-hydroxy-2,4-dimethylbenzaldehyde (CAS 81322-67-0) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 3-chloro-6-hydroxy-2,4-dimethylbenzaldehyde. InChIKey: NXNLQPJNVDGFOE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 3-chloro-6-hydroxy-2,4-dimethylbenzaldehyde |
| InChIKey | NXNLQPJNVDGFOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Cl)C)C=O)O |
Computed by PubChem (NCBI)