Products 81465-91-0
CAS 81465-91-0 appears in our catalog under these names: 6-Trifluoromethyl-benzo[d]isoxazol-3-ylamine, 95%, 6-Trifluoromethyl-benzo(D)isoxazol-3-ylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
6-(trifluoromethyl)-1,2-benzoxazol-3-amine (CAS 81465-91-0) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 6-(trifluoromethyl)-1,2-benzoxazol-3-amine. InChIKey: YYCXXQOOYBPTDY-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1,2-benzoxazol-3-amine |
| InChIKey | YYCXXQOOYBPTDY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)ON=C2N |
Computed by PubChem (NCBI)