CAS 81496-82-4 is the registry number for Dihydroartemisinin, 98%, mixture of α and β isomers, 98%, mixture of α and β isomers. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 15g, 50g.
Artenimol is an artemisinin derivative.
Source: ChEBI
| Molecular formula | C15H24O5 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | (1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-ol |
| InChIKey | BJDCWCLMFKKGEE-ISOSDAIHSA-N |
| SMILES | C[C@@H]1CC[C@H]2[C@H]([C@H](O[C@H]3[C@@]24[C@H]1CC[C@](O3)(OO4)C)O)C |
Computed by PubChem (NCBI)