Products 815576-23-9

CAS 815576-23-9 is the registry number for 4-(3-Fluorophenoxy)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-(3-fluorophenoxy)benzenesulfonyl chloride (CAS 815576-23-9) is a chemical compound with the molecular formula C12H8ClFO3S and a molecular weight of 286.71 g/mol. IUPAC name: 4-(3-fluorophenoxy)benzenesulfonyl chloride. InChIKey: CTPANYMCABKYLN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClFO3S
Molecular weight286.71 g/mol
IUPAC name4-(3-fluorophenoxy)benzenesulfonyl chloride
InChIKeyCTPANYMCABKYLN-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)OC2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)