CAS 934127-20-5 is the registry number for 5-(2-Chloro-4-fluorophenoxymethyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-[(2-chloro-4-fluorophenoxy)methyl]thiophene-2-carboxylic acid (CAS 934127-20-5) is a chemical compound with the molecular formula C12H8ClFO3S and a molecular weight of 286.71 g/mol. IUPAC name: 5-[(2-chloro-4-fluorophenoxy)methyl]thiophene-2-carboxylic acid. InChIKey: ZGFFSPKCSZGCAQ-UHFFFAOYSA-N.
| Molecular formula | C12H8ClFO3S |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | 5-[(2-chloro-4-fluorophenoxy)methyl]thiophene-2-carboxylic acid |
| InChIKey | ZGFFSPKCSZGCAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)OCC2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)