Products 934127-20-5

CAS 934127-20-5 is the registry number for 5-(2-Chloro-4-fluorophenoxymethyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-[(2-chloro-4-fluorophenoxy)methyl]thiophene-2-carboxylic acid (CAS 934127-20-5) is a chemical compound with the molecular formula C12H8ClFO3S and a molecular weight of 286.71 g/mol. IUPAC name: 5-[(2-chloro-4-fluorophenoxy)methyl]thiophene-2-carboxylic acid. InChIKey: ZGFFSPKCSZGCAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClFO3S
Molecular weight286.71 g/mol
IUPAC name5-[(2-chloro-4-fluorophenoxy)methyl]thiophene-2-carboxylic acid
InChIKeyZGFFSPKCSZGCAQ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)Cl)OCC2=CC=C(S2)C(=O)O

Computed by PubChem (NCBI)