CAS 81577-58-4 appears in our catalog under these names: (4S,5R)-4-(Hydroxymethyl)-2-phenyl-1,3-dioxan-5-ol, 98%, 1,3-(S)-O-BENZYLIDENE-D-THREITOL, >=98%&. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 100MG.
(2S,4R,5R)-4-(hydroxymethyl)-2-phenyl-1,3-dioxan-5-ol (CAS 81577-58-4) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: (2S,4R,5R)-4-(hydroxymethyl)-2-phenyl-1,3-dioxan-5-ol. InChIKey: GUOMTMWCUMBRFX-MXWKQRLJSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | (2S,4R,5R)-4-(hydroxymethyl)-2-phenyl-1,3-dioxan-5-ol |
| InChIKey | GUOMTMWCUMBRFX-MXWKQRLJSA-N |
| SMILES | C1[C@H]([C@H](O[C@H](O1)C2=CC=CC=C2)CO)O |
Computed by PubChem (NCBI)