Products 81834-79-9

CAS 81834-79-9 is the registry number for 7-(3-hydroxy-5-oxo-1-cyclopenten-1-yl)-(5Z)--Heptenoic acid-1-Methylethyl ester, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Propan-2-yl (Z)-7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate (CAS 81834-79-9) is a chemical compound with the molecular formula C15H22O4 and a molecular weight of 266.33 g/mol. IUPAC name: propan-2-yl (Z)-7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate. InChIKey: HFDZDSYCBJZTAQ-HYXAFXHYSA-N.

Identity
Molecular formulaC15H22O4
Molecular weight266.33 g/mol
IUPAC namepropan-2-yl (Z)-7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate
InChIKeyHFDZDSYCBJZTAQ-HYXAFXHYSA-N
SMILESCC(C)OC(=O)CCC/C=C\CC1=CC(CC1=O)O

Computed by PubChem (NCBI)