Products 819058-89-4
CAS 819058-89-4 is the registry number for FLT3-IN-26. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-aminophenyl)-1H-indazol-3-amine (CAS 819058-89-4) is a chemical compound with the molecular formula C13H12N4 and a molecular weight of 224.26 g/mol. IUPAC name: 4-(4-aminophenyl)-1H-indazol-3-amine. InChIKey: KHQLSBOHZQJRPC-UHFFFAOYSA-N.
| Molecular formula | C13H12N4 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 4-(4-aminophenyl)-1H-indazol-3-amine |
| InChIKey | KHQLSBOHZQJRPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NN=C2N)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)