Products 81968-62-9
CAS 81968-62-9 appears in our catalog under these names: 4(15),5,10(14)-Germacratrien-1-ol, ≥98%, ≥98%, 1β-Hydroxy-4(15),5E,10(14)-germacratriene. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 5 mg, 1 mg.
(5Z,7S)-4,10-dimethylidene-7-propan-2-ylcyclodec-5-en-1-ol (CAS 81968-62-9) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (5Z,7S)-4,10-dimethylidene-7-propan-2-ylcyclodec-5-en-1-ol. InChIKey: OSSWBZXPRYZGRO-GNOUIQMSSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (5Z,7S)-4,10-dimethylidene-7-propan-2-ylcyclodec-5-en-1-ol |
| InChIKey | OSSWBZXPRYZGRO-GNOUIQMSSA-N |
| SMILES | CC(C)[C@@H]/1CCC(=C)C(CCC(=C)/C=C1)O |
Computed by PubChem (NCBI)