CAS 82050-10-0 appears in our catalog under these names: 2-Amino-3-methyl-3H-imidazo(4,5-f)quinoline-d3, >95% (HPLC), 2-Amino-3-methyl-3H-imidazo[4,5-f]quinoline-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
3-(trideuteriomethyl)imidazo[4,5-f]quinolin-2-amine (CAS 82050-10-0) is a chemical compound with the molecular formula C11H10N4 and a molecular weight of 201.24 g/mol. IUPAC name: 3-(trideuteriomethyl)imidazo[4,5-f]quinolin-2-amine. InChIKey: ARZWATDYIYAUTA-FIBGUPNXSA-N.
| Molecular formula | C11H10N4 |
|---|---|
| Molecular weight | 201.24 g/mol |
| IUPAC name | 3-(trideuteriomethyl)imidazo[4,5-f]quinolin-2-amine |
| InChIKey | ARZWATDYIYAUTA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C3=C(C=C2)N=CC=C3)N=C1N |
Computed by PubChem (NCBI)