CAS 82121-08-2 appears in our catalog under these names: 4-Hydroxy-7-methylquinoline, 95%, 7-Methylquinolin-4-ol, 98%, 7–Methylquinolin–4–ol, 7-Methylquinolin-4-ol, 97%, 97%, 7-methyl-1,4-dihydroquinolin-4-one, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
7-methyl-1H-quinolin-4-one (CAS 82121-08-2) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 7-methyl-1H-quinolin-4-one. InChIKey: JPVTWKDGBWUNBQ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 7-methyl-1H-quinolin-4-one |
| InChIKey | JPVTWKDGBWUNBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)C=CN2 |
Computed by PubChem (NCBI)