Products 82211-69-6
CAS 82211-69-6 is the registry number for 6-(2-Aminoacetyl)-2,3-dihydro-1,3-benzoxazol-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2-aminoacetyl)-3H-1,3-benzoxazol-2-one;hydrochloride (CAS 82211-69-6) is a chemical compound with the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. IUPAC name: 6-(2-aminoacetyl)-3H-1,3-benzoxazol-2-one;hydrochloride. InChIKey: ZICABSAWLJRRPG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 6-(2-aminoacetyl)-3H-1,3-benzoxazol-2-one;hydrochloride |
| InChIKey | ZICABSAWLJRRPG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)CN)OC(=O)N2.Cl |
Computed by PubChem (NCBI)