Products 82414-31-1
CAS 82414-31-1 is the registry number for 1-Methyl-N-phenyl-1H-indole-3-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-N-phenylindole-3-carboxamide (CAS 82414-31-1) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: 1-methyl-N-phenylindole-3-carboxamide. InChIKey: OEZFAXRACDZTJB-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 1-methyl-N-phenylindole-3-carboxamide |
| InChIKey | OEZFAXRACDZTJB-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)