CAS 82420-35-7 appears in our catalog under these names: 2–(Bromomethyl)–4–fluoro–1–nitrobenzene, 2-(Bromomethyl)-4-fluoro-1-nitrobenzene, 2-(Bromomethyl)-4-fluoro-1-nitrobenzene, 95%. Offered by: GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g, 10g.
2-(bromomethyl)-4-fluoro-1-nitrobenzene (CAS 82420-35-7) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 2-(bromomethyl)-4-fluoro-1-nitrobenzene. InChIKey: ZODQWFPDKBKNTF-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 2-(bromomethyl)-4-fluoro-1-nitrobenzene |
| InChIKey | ZODQWFPDKBKNTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)