CAS 824430-77-5 appears in our catalog under these names: Lorcaserin Lactam Impurity, 2-Oxo Lorcaserin. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
7-chloro-5-methyl-1,2,3,5-tetrahydro-3-benzazepin-4-one (CAS 824430-77-5) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: 7-chloro-5-methyl-1,2,3,5-tetrahydro-3-benzazepin-4-one. InChIKey: GWMXBSJNHZORGS-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 7-chloro-5-methyl-1,2,3,5-tetrahydro-3-benzazepin-4-one |
| InChIKey | GWMXBSJNHZORGS-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CCNC1=O)C=CC(=C2)Cl |
Computed by PubChem (NCBI)