CAS 82463-21-6 is the registry number for Epizizanal. Offered by: TRC. Available pack sizes: 25mg.
(1R,2R,5S,8R)-7,7-dimethyl-6-methylidenetricyclo[6.2.1.01,5]undecane-2-carbaldehyde (CAS 82463-21-6) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (1R,2R,5S,8R)-7,7-dimethyl-6-methylidenetricyclo[6.2.1.01,5]undecane-2-carbaldehyde. InChIKey: ONCLDGVLVUPPIN-COMQUAJESA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (1R,2R,5S,8R)-7,7-dimethyl-6-methylidenetricyclo[6.2.1.01,5]undecane-2-carbaldehyde |
| InChIKey | ONCLDGVLVUPPIN-COMQUAJESA-N |
| SMILES | CC1([C@@H]2CC[C@]3(C2)[C@@H](CC[C@@H]3C1=C)C=O)C |
Computed by PubChem (NCBI)