Products 82520-40-9
CAS 82520-40-9 is the registry number for (2-Chlorophenyl)(4-ethylphenyl)methanone. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(2-chlorophenyl)-(4-ethylphenyl)methanone (CAS 82520-40-9) is a chemical compound with the molecular formula C15H13ClO and a molecular weight of 244.71 g/mol. IUPAC name: (2-chlorophenyl)-(4-ethylphenyl)methanone. InChIKey: UNGPISHBPOQJDW-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO |
|---|---|
| Molecular weight | 244.71 g/mol |
| IUPAC name | (2-chlorophenyl)-(4-ethylphenyl)methanone |
| InChIKey | UNGPISHBPOQJDW-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)