Products 82570-34-1
CAS 82570-34-1 is the registry number for Lemnalol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,2S,4R,6R,7S,8S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decan-4-ol (CAS 82570-34-1) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (1R,2S,4R,6R,7S,8S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decan-4-ol. InChIKey: LPXOPRGPLUWGKB-VRPMWHRCSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (1R,2S,4R,6R,7S,8S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decan-4-ol |
| InChIKey | LPXOPRGPLUWGKB-VRPMWHRCSA-N |
| SMILES | CC(C)[C@@H]1CC[C@@]2([C@H]3[C@H]1[C@@H]2C(=C)[C@@H](C3)O)C |
Computed by PubChem (NCBI)