CAS 826-10-8 appears in our catalog under these names: R-(-)-Methamphetamine Hydrochloride, R-(-)-Methamphetamine Hydrochloride (1.0mg/ml in Acetonitrile), l-Methamphetamine.HCl, l-Methamphetamine.HCl, 1mg/ml in Methanol (as free base). Offered by: TRC, Lipomed. Available pack sizes: 100mg, 25mg, 5mg, 1x1ml, 50mg, 10mg, 1ml.
(2R)-N-methyl-1-phenylpropan-2-amine;hydrochloride (CAS 826-10-8) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (2R)-N-methyl-1-phenylpropan-2-amine;hydrochloride. InChIKey: TWXDDNPPQUTEOV-SBSPUUFOSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (2R)-N-methyl-1-phenylpropan-2-amine;hydrochloride |
| InChIKey | TWXDDNPPQUTEOV-SBSPUUFOSA-N |
| SMILES | C[C@H](CC1=CC=CC=C1)NC.Cl |
Computed by PubChem (NCBI)