CAS 827-46-3 is the registry number for 2-Phenylthiazol-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenyl-1,3-thiazol-4-one (CAS 827-46-3) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 2-phenyl-1,3-thiazol-4-one. InChIKey: LFLIZASYILFMIO-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazol-4-one |
| InChIKey | LFLIZASYILFMIO-UHFFFAOYSA-N |
| SMILES | C1C(=O)N=C(S1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)