CAS 82756-24-9 is the registry number for 2-Chloro-5,6-dimethylnicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-chloro-5,6-dimethylpyridine-3-carboxamide (CAS 82756-24-9) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 2-chloro-5,6-dimethylpyridine-3-carboxamide. InChIKey: IQLIVLJINUELSH-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 2-chloro-5,6-dimethylpyridine-3-carboxamide |
| InChIKey | IQLIVLJINUELSH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1C)Cl)C(=O)N |
Computed by PubChem (NCBI)