CAS 828-06-8 appears in our catalog under these names: 3,4-Dihydroxy Amphetamine Hydrochloride, 3,4–Dihydroxyamphetamine (hydrochloride), 3,4-Dihydroxyamphetamine (hydrochloride). Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 750mg, 1mg, 5mg, 1 mg, 5 mg.
4-(2-aminopropyl)benzene-1,2-diol;hydrochloride (CAS 828-06-8) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: 4-(2-aminopropyl)benzene-1,2-diol;hydrochloride. InChIKey: MCRAZJGRCJLDOI-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 4-(2-aminopropyl)benzene-1,2-diol;hydrochloride |
| InChIKey | MCRAZJGRCJLDOI-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)O)O)N.Cl |
Computed by PubChem (NCBI)