Products 82869-24-7
CAS 82869-24-7 is the registry number for Methyl Artemisinate. Offered by: TRC. Available pack sizes: 100mg.
Methyl 2-[(1R,4R,4aS,8aR)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoate (CAS 82869-24-7) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: methyl 2-[(1R,4R,4aS,8aR)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoate. InChIKey: AOBAHYLCIGMCHX-UNQGMJICSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | methyl 2-[(1R,4R,4aS,8aR)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoate |
| InChIKey | AOBAHYLCIGMCHX-UNQGMJICSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H]2[C@H]1CCC(=C2)C)C(=C)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Methyl artemisinate